6577 Results for: "Fmoc-Orn(Alloc)-OH"

Supplier: Merck

LiChrospher® is Merck's reliable and versatile, traditionally-produced, spherical silica. LiChrospher® is available with different modifications.

Supplier: G-Biosciences

n6-(benzyloxycarbonyl)-l-lysine is a protected amino acid. cas number: 1155-64-2 synonym: n-z-l-lysine, n6-carbobenzyloxy-l-lysine linear formula: 6h5ch2oocnh(ch2)4ch(nh2)cooh molecular weight: 280.32 1 * 25 g

Supplier: G-Biosciences

n6-(benzyloxycarbonyl)-l-lysine is a protected amino acid cas number: 1155-64-2 synonym: n-z-l-lysine, n6-carbobenzyloxy-l-lysine linear formula: c6h5ch2oocnh(ch2)4ch(nh2)cooh molecular weight: 280.32 1 * 100 g

Supplier: MACHEREY-NAGEL

[EN]COLUMN EC 250/4.6 NUCLEOSIL 1000-7OH 1 * 1 ST

Supplier: Amarell

Viscometer therm. for the falling ball and the ball-draw viscometer, null

Supplier: Amarell

Viscometer therm. for the falling ball and the ball-draw viscometer, null

Supplier: Amarell

Viscometer therm. for the falling ball and the ball-draw viscometer, null